C28H30ClF3O12S — CID 162583798
[(2R,3R,5S,6S)-3,5-diacetyloxy-6-[4-chloro-3-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]phenyl]-4-(1-hydroxyethoxy)oxan-2-yl]methyl acetate (PubChem CID 162583798) has the molecular formula C28H30ClF3O12S and a molecular weight of 683.05 g/mol. Its IUPAC name is [(2R,3R,5S,6S)-3,5-diacetyloxy-6-[4-chloro-3-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]phenyl]-4-(1-hydroxyethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,5S,6S)-3,5-diacetyloxy-6-[4-chloro-3-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]phenyl]-4-(1-hydroxyethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162583798 |
| Molecular Formula | C28H30ClF3O12S |
| Molecular Weight | 683.05 g/mol |
| Exact Mass | 682.11 |
| IUPAC Name | [(2R,3R,5S,6S)-3,5-diacetyloxy-6-[4-chloro-3-[[4-(trifluoromethylsulfonyloxy)phenyl]methyl]phenyl]-4-(1-hydroxyethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OS(=O)(=O)C(F)(F)F)cc3)c2)[C@H](OC(C)=O)C(OC(C)O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H30ClF3O12S/c1-14(33)39-13-23-25(40-15(2)34)27(42-17(4)36)26(41-16(3)35)24(43-23)19-7-10-22(29)20(12-19)11-18-5-8-21(9-6-18)44-45(37,38)28(30,31)32/h5-10,12,17,23-27,36H,11,13H2,1-4H3/t17?,23-,24+,25-,26+,27?/m1/s1 |
| InChIKey | HQTSKKWJQUSPFF-DWFNPTLUSA-N |
| XLogP | 3.75 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.05 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|