C34H41ClO10 — CID 66582812
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[(1-ethylcyclobutyl)methoxy]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 66582812) has the molecular formula C34H41ClO10 and a molecular weight of 645.14 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[(1-ethylcyclobutyl)methoxy]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[(1-ethylcyclobutyl)methoxy]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66582812 |
| Molecular Formula | C34H41ClO10 |
| Molecular Weight | 645.14 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[(1-ethylcyclobutyl)methoxy]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CCC1(COc2ccc(Cc3cc([C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)ccc3Cl)cc2)CCC1 |
| InChI | InChI=1S/C34H41ClO10/c1-6-34(14-7-15-34)19-41-27-11-8-24(9-12-27)16-26-17-25(10-13-28(26)35)30-32(43-22(4)38)33(44-23(5)39)31(42-21(3)37)29(45-30)18-40-20(2)36/h8-13,17,29-33H,6-7,14-16,18-19H2,1-5H3/t29-,30+,31-,32+,33+/m1/s1 |
| InChIKey | YMWFFEBNEDRNEW-LNALEXQMSA-N |
| XLogP | 5.69 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.14 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|