C30H34ClNO10 — CID 89442828
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(2-methoxyiminoethyl)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 89442828) has the molecular formula C30H34ClNO10 and a molecular weight of 604.05 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(2-methoxyiminoethyl)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(2-methoxyiminoethyl)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89442828 |
| Molecular Formula | C30H34ClNO10 |
| Molecular Weight | 604.05 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-(2-methoxyiminoethyl)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CON=CCc1ccc(Cc2cc([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C30H34ClNO10/c1-17(33)38-16-26-28(39-18(2)34)30(41-20(4)36)29(40-19(3)35)27(42-26)23-10-11-25(31)24(15-23)14-22-8-6-21(7-9-22)12-13-32-37-5/h6-11,13,15,26-30H,12,14,16H2,1-5H3/t26-,27+,28-,29+,30+/m1/s1 |
| InChIKey | BRAALULQLZYIQY-MYOTWTRRSA-N |
| XLogP | 3.90 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.05 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|