C31H34N2O11 — CID 131732776
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-cyano-3-[[4-(2-methoxyiminoethoxy)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 131732776) has the molecular formula C31H34N2O11 and a molecular weight of 610.62 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-cyano-3-[[4-(2-methoxyiminoethoxy)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-cyano-3-[[4-(2-methoxyiminoethoxy)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 131732776 |
| Molecular Formula | C31H34N2O11 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-cyano-3-[[4-(2-methoxyiminoethoxy)phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CON=CCOc1ccc(Cc2cc([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2C#N)cc1 |
| InChI | InChI=1S/C31H34N2O11/c1-18(34)40-17-27-29(41-19(2)35)31(43-21(4)37)30(42-20(3)36)28(44-27)23-8-9-24(16-32)25(15-23)14-22-6-10-26(11-7-22)39-13-12-33-38-5/h6-12,15,27-31H,13-14,17H2,1-5H3/t27-,28+,29-,30+,31+/m1/s1 |
| InChIKey | GEMUADDGSVZFKC-WUWJBHAQSA-N |
| XLogP | 2.96 |
| TPSA | 169.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|