C29H34O9S — CID 71098872
[(2R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-methyl-3-[(4-methylsulfanylphenyl)methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 71098872) has the molecular formula C29H34O9S and a molecular weight of 558.65 g/mol. Its IUPAC name is [(2R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-methyl-3-[(4-methylsulfanylphenyl)methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-methyl-3-[(4-methylsulfanylphenyl)methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71098872 |
| Molecular Formula | C29H34O9S |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | [(2R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-methyl-3-[(4-methylsulfanylphenyl)methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CSc1ccc(Cc2cc([C@@H]3O[C@H](COC(C)=O)C(OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2C)cc1 |
| InChI | InChI=1S/C29H34O9S/c1-16-7-10-22(14-23(16)13-21-8-11-24(39-6)12-9-21)26-28(36-19(4)32)29(37-20(5)33)27(35-18(3)31)25(38-26)15-34-17(2)30/h7-12,14,25-29H,13,15H2,1-6H3/t25-,26+,27?,28+,29+/m1/s1 |
| InChIKey | QHNANAUYNCQOBK-QRGVUDOSSA-N |
| XLogP | 4.11 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|