C32H35NO9S — CID 71073121
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-cyano-3-[(4-cyclopropylphenyl)methyl]-5-methylsulfanylphenyl]oxan-2-yl]methyl acetate (PubChem CID 71073121) has the molecular formula C32H35NO9S and a molecular weight of 609.70 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-cyano-3-[(4-cyclopropylphenyl)methyl]-5-methylsulfanylphenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-cyano-3-[(4-cyclopropylphenyl)methyl]-5-methylsulfanylphenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71073121 |
| Molecular Formula | C32H35NO9S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-cyano-3-[(4-cyclopropylphenyl)methyl]-5-methylsulfanylphenyl]oxan-2-yl]methyl acetate |
| SMILES | CSc1cc([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc(Cc2ccc(C3CC3)cc2)c1C#N |
| InChI | InChI=1S/C32H35NO9S/c1-17(34)38-16-27-30(39-18(2)35)32(41-20(4)37)31(40-19(3)36)29(42-27)25-13-24(26(15-33)28(14-25)43-5)12-21-6-8-22(9-7-21)23-10-11-23/h6-9,13-14,23,27,29-32H,10-12,16H2,1-5H3/t27-,29+,30-,31+,32+/m1/s1 |
| InChIKey | BQPPNBVPGYBELQ-IFUGWHCZSA-N |
| XLogP | 4.55 |
| TPSA | 138.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|