C28H29NO10 — CID 154026413
[(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-cyano-3-(phenoxymethyl)phenyl]oxan-2-yl]methyl acetate (PubChem CID 154026413) has the molecular formula C28H29NO10 and a molecular weight of 539.54 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-cyano-3-(phenoxymethyl)phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-cyano-3-(phenoxymethyl)phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 154026413 |
| Molecular Formula | C28H29NO10 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-cyano-3-(phenoxymethyl)phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(c2ccc(C#N)c(COc3ccccc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H29NO10/c1-16(30)34-15-24-26(36-17(2)31)28(38-19(4)33)27(37-18(3)32)25(39-24)20-10-11-21(13-29)22(12-20)14-35-23-8-6-5-7-9-23/h5-12,24-28H,14-15H2,1-4H3/t24-,25?,26-,27+,28+/m1/s1 |
| InChIKey | MVEUMOZYROMEGB-SOSKXODKSA-N |
| XLogP | 2.94 |
| TPSA | 147.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|