C27H35ClO9 — CID 141258645
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(cyclohexylmethyl)phenyl]oxan-2-yl]methyl acetate (PubChem CID 141258645) has the molecular formula C27H35ClO9 and a molecular weight of 539.02 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(cyclohexylmethyl)phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(cyclohexylmethyl)phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 141258645 |
| Molecular Formula | C27H35ClO9 |
| Molecular Weight | 539.02 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(cyclohexylmethyl)phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(CC3CCCCC3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H35ClO9/c1-15(29)33-14-23-25(34-16(2)30)27(36-18(4)32)26(35-17(3)31)24(37-23)20-10-11-22(28)21(13-20)12-19-8-6-5-7-9-19/h10-11,13,19,23-27H,5-9,12,14H2,1-4H3/t23-,24+,25-,26+,27+/m1/s1 |
| InChIKey | IQKNXGKFZUAZQZ-MMKSVXGCSA-N |
| XLogP | 4.26 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.02 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|