C30H42O10 — CID 159587293
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-hydroxy-3-[(4-propylcyclohexyl)methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 159587293) has the molecular formula C30H42O10 and a molecular weight of 562.66 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-hydroxy-3-[(4-propylcyclohexyl)methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-hydroxy-3-[(4-propylcyclohexyl)methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 159587293 |
| Molecular Formula | C30H42O10 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-hydroxy-3-[(4-propylcyclohexyl)methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CCCC1CCC(Cc2cc([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2O)CC1 |
| InChI | InChI=1S/C30H42O10/c1-6-7-21-8-10-22(11-9-21)14-24-15-23(12-13-25(24)35)27-29(38-19(4)33)30(39-20(5)34)28(37-18(3)32)26(40-27)16-36-17(2)31/h12-13,15,21-22,26-30,35H,6-11,14,16H2,1-5H3/t21?,22?,26-,27+,28-,29+,30+/m1/s1 |
| InChIKey | MJTZADSYNWGCCM-KLCFKPMXSA-N |
| XLogP | 4.34 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|