C26H28Cl2N2O9 — CID 87411863
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(6-chloro-5-methylpyridazin-3-yl)methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 87411863) has the molecular formula C26H28Cl2N2O9 and a molecular weight of 583.42 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(6-chloro-5-methylpyridazin-3-yl)methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(6-chloro-5-methylpyridazin-3-yl)methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87411863 |
| Molecular Formula | C26H28Cl2N2O9 |
| Molecular Weight | 583.42 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(6-chloro-5-methylpyridazin-3-yl)methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3cc(C)c(Cl)nn3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H28Cl2N2O9/c1-12-8-19(29-30-26(12)28)10-18-9-17(6-7-20(18)27)22-24(37-15(4)33)25(38-16(5)34)23(36-14(3)32)21(39-22)11-35-13(2)31/h6-9,21-25H,10-11H2,1-5H3/t21-,22+,23-,24+,25+/m1/s1 |
| InChIKey | GDPZSPMKFYBGEI-KJWQXZETSA-N |
| XLogP | 3.48 |
| TPSA | 140.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|