C28H29ClF2O9 — CID 58017733
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(2,3-difluoro-4-methylphenyl)methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 58017733) has the molecular formula C28H29ClF2O9 and a molecular weight of 582.98 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(2,3-difluoro-4-methylphenyl)methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(2,3-difluoro-4-methylphenyl)methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58017733 |
| Molecular Formula | C28H29ClF2O9 |
| Molecular Weight | 582.98 g/mol |
| Exact Mass | 582.15 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(2,3-difluoro-4-methylphenyl)methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(C)c(F)c3F)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H29ClF2O9/c1-13-6-7-18(24(31)23(13)30)10-20-11-19(8-9-21(20)29)25-27(38-16(4)34)28(39-17(5)35)26(37-15(3)33)22(40-25)12-36-14(2)32/h6-9,11,22,25-28H,10,12H2,1-5H3/t22-,25+,26-,27+,28+/m1/s1 |
| InChIKey | OIUFNZGOWJSNBB-LSNQXMIESA-N |
| XLogP | 4.32 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.98 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|