C32H36O11 — CID 67115857
[(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-cyclopropyl-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]oxan-2-yl]methyl acetate (PubChem CID 67115857) has the molecular formula C32H36O11 and a molecular weight of 596.63 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-cyclopropyl-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-cyclopropyl-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67115857 |
| Molecular Formula | C32H36O11 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-[4-cyclopropyl-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(c2ccc(C3CC3)c(Cc3ccc4c(c3)OCCO4)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H36O11/c1-17(33)39-16-28-30(40-18(2)34)32(42-20(4)36)31(41-19(3)35)29(43-28)23-8-9-25(22-6-7-22)24(15-23)13-21-5-10-26-27(14-21)38-12-11-37-26/h5,8-10,14-15,22,28-32H,6-7,11-13,16H2,1-4H3/t28-,29?,30-,31+,32+/m1/s1 |
| InChIKey | WGTFHBOPFPZZFH-BXZFMWHFSA-N |
| XLogP | 3.72 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|