C30H36O7 — CID 126595644
[(2R,3S,4S,5R,6S)-5-acetyloxy-6-[4-cyclopropyl-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-2-ethyl-4-methyloxan-3-yl] acetate (PubChem CID 126595644) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[4-cyclopropyl-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-2-ethyl-4-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[4-cyclopropyl-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-2-ethyl-4-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 126595644 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-6-[4-cyclopropyl-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-2-ethyl-4-methyloxan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](c2ccc(C3CC3)c(Cc3ccc4c(c3)OCCO4)c2)[C@H](OC(C)=O)[C@@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H36O7/c1-5-25-28(35-18(3)31)17(2)29(36-19(4)32)30(37-25)22-9-10-24(21-7-8-21)23(16-22)14-20-6-11-26-27(15-20)34-13-12-33-26/h6,9-11,15-17,21,25,28-30H,5,7-8,12-14H2,1-4H3/t17-,25+,28-,29+,30-/m0/s1 |
| InChIKey | MPQZVTPDVIJDTB-QLUZHBKISA-N |
| XLogP | 5.28 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |