C27H33BrO4 — CID 58340823
[(2S,3R,4S,5S,6R)-2-[4-bromo-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-6-ethyl-4,5-dimethyloxan-3-yl] acetate (PubChem CID 58340823) has the molecular formula C27H33BrO4 and a molecular weight of 501.46 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2-[4-bromo-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-6-ethyl-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-2-[4-bromo-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 58340823 |
| Molecular Formula | C27H33BrO4 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2-[4-bromo-3-(3,4-dihydro-2H-chromen-6-ylmethyl)phenyl]-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Br)c(Cc3ccc4c(c3)CCCO4)c2)[C@H](OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C27H33BrO4/c1-5-24-16(2)17(3)26(31-18(4)29)27(32-24)21-9-10-23(28)22(15-21)14-19-8-11-25-20(13-19)7-6-12-30-25/h8-11,13,15-17,24,26-27H,5-7,12,14H2,1-4H3/t16-,17-,24+,26+,27-/m0/s1 |
| InChIKey | CDFDQCGWXYYZER-RFCHCJPFSA-N |
| XLogP | 6.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |