C41H46O4 — CID 126595440
6-[[2-cyclopropyl-5-[(3R,4S,5S,6R)-6-ethyl-4-methyl-3,5-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]-3,4-dihydro-2H-chromene (PubChem CID 126595440) has the molecular formula C41H46O4 and a molecular weight of 602.82 g/mol. Its IUPAC name is 6-[[2-cyclopropyl-5-[(3R,4S,5S,6R)-6-ethyl-4-methyl-3,5-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[[2-cyclopropyl-5-[(3R,4S,5S,6R)-6-ethyl-4-methyl-3,5-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 126595440 |
| Molecular Formula | C41H46O4 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | 6-[[2-cyclopropyl-5-[(3R,4S,5S,6R)-6-ethyl-4-methyl-3,5-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]-3,4-dihydro-2H-chromene |
| SMILES | CC[C@H]1OC(c2ccc(C3CC3)c(Cc3ccc4c(c3)CCCO4)c2)[C@H](OCc2ccccc2)[C@@H](C)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H46O4/c1-3-37-39(43-26-29-11-6-4-7-12-29)28(2)40(44-27-30-13-8-5-9-14-30)41(45-37)34-19-20-36(32-17-18-32)35(25-34)24-31-16-21-38-33(23-31)15-10-22-42-38/h4-9,11-14,16,19-21,23,25,28,32,37,39-41H,3,10,15,17-18,22,24,26-27H2,1-2H3/t28-,37+,39-,40+,41?/m0/s1 |
| InChIKey | IIDRFXABJPFUKQ-PIELBCJSSA-N |
| XLogP | 9.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |