C41H46ClNO4 — CID 58403639
N-[[4-[[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]phenyl]methyl]-N-cyclopropylacetamide (PubChem CID 58403639) has the molecular formula C41H46ClNO4 and a molecular weight of 652.28 g/mol. Its IUPAC name is N-[[4-[[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]phenyl]methyl]-N-cyclopropylacetamide.
| Compound Name | N-[[4-[[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]phenyl]methyl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 58403639 |
| Molecular Formula | C41H46ClNO4 |
| Molecular Weight | 652.28 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | N-[[4-[[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]phenyl]methyl]-N-cyclopropylacetamide |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(CN(C(C)=O)C4CC4)cc3)c2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C41H46ClNO4/c1-4-38-28(2)39(45-26-32-11-7-5-8-12-32)41(46-27-33-13-9-6-10-14-33)40(47-38)34-19-22-37(42)35(24-34)23-30-15-17-31(18-16-30)25-43(29(3)44)36-20-21-36/h5-19,22,24,28,36,38-41H,4,20-21,23,25-27H2,1-3H3/t28-,38-,39+,40+,41-/m1/s1 |
| InChIKey | ZNMYOLYSWZPAEV-OTLOMUJJSA-N |
| XLogP | 9.10 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.28 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |