C39H39ClN2O3 — CID 67471381
3-[[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]-6-phenylpyridazine (PubChem CID 67471381) has the molecular formula C39H39ClN2O3 and a molecular weight of 619.21 g/mol. Its IUPAC name is 3-[[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]-6-phenylpyridazine.
| Compound Name | 3-[[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]-6-phenylpyridazine |
|---|---|
| PubChem CID | 67471381 |
| Molecular Formula | C39H39ClN2O3 |
| Molecular Weight | 619.21 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | 3-[[2-chloro-5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenyl]methyl]-6-phenylpyridazine |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(-c4ccccc4)nn3)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C39H39ClN2O3/c1-3-36-27(2)37(43-25-28-13-7-4-8-14-28)39(44-26-29-15-9-5-10-16-29)38(45-36)31-19-21-34(40)32(23-31)24-33-20-22-35(42-41-33)30-17-11-6-12-18-30/h4-23,27,36-39H,3,24-26H2,1-2H3/t27-,36-,37+,38+,39?/m1/s1 |
| InChIKey | BKWALIIIXHCBFI-XXWLZKFQSA-N |
| XLogP | 9.04 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.21 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |