C37H39ClO3 — CID 58403635
(2S,3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethenylphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane (PubChem CID 58403635) has the molecular formula C37H39ClO3 and a molecular weight of 567.17 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethenylphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethenylphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 58403635 |
| Molecular Formula | C37H39ClO3 |
| Molecular Weight | 567.17 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethenylphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxane |
| SMILES | C=Cc1ccc(Cc2cc([C@@H]3O[C@H](CC)[C@@H](C)[C@H](OCc4ccccc4)C3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C37H39ClO3/c1-4-27-16-18-28(19-17-27)22-32-23-31(20-21-33(32)38)36-37(40-25-30-14-10-7-11-15-30)35(26(3)34(5-2)41-36)39-24-29-12-8-6-9-13-29/h4,6-21,23,26,34-37H,1,5,22,24-25H2,2-3H3/t26-,34-,35+,36+,37?/m1/s1 |
| InChIKey | MKHDYJZVSQGWBC-YGGNESINSA-N |
| XLogP | 9.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.17 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |