C41H47ClO6 — CID 90308369
(Z)-4-[5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenoxy]but-2-en-1-ol (PubChem CID 90308369) has the molecular formula C41H47ClO6 and a molecular weight of 671.27 g/mol. Its IUPAC name is (Z)-4-[5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenoxy]but-2-en-1-ol.
| Compound Name | (Z)-4-[5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenoxy]but-2-en-1-ol |
|---|---|
| PubChem CID | 90308369 |
| Molecular Formula | C41H47ClO6 |
| Molecular Weight | 671.27 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | (Z)-4-[5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenoxy]but-2-en-1-ol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CC)[C@@H](C)[C@H](OCc4ccccc4)C3OCc3ccccc3)c(OC/C=C\CO)cc2Cl)cc1 |
| InChI | InChI=1S/C41H47ClO6/c1-4-37-29(3)39(46-27-31-14-8-6-9-15-31)41(47-28-32-16-10-7-11-17-32)40(48-37)35-25-33(24-30-18-20-34(21-19-30)44-5-2)36(42)26-38(35)45-23-13-12-22-43/h6-21,25-26,29,37,39-41,43H,4-5,22-24,27-28H2,1-3H3/b13-12-/t29-,37-,39+,40+,41?/m1/s1 |
| InChIKey | UYAGXFZMDIWLHN-WTJMWQHVSA-N |
| XLogP | 8.91 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.27 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|