C37H40BrClO5 — CID 90086944
2-bromo-6-chloro-5-[(4-ethoxyphenyl)methyl]-3-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenol (PubChem CID 90086944) has the molecular formula C37H40BrClO5 and a molecular weight of 680.08 g/mol. Its IUPAC name is 2-bromo-6-chloro-5-[(4-ethoxyphenyl)methyl]-3-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenol.
| Compound Name | 2-bromo-6-chloro-5-[(4-ethoxyphenyl)methyl]-3-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenol |
|---|---|
| PubChem CID | 90086944 |
| Molecular Formula | C37H40BrClO5 |
| Molecular Weight | 680.08 g/mol |
| Exact Mass | 678.17 |
| IUPAC Name | 2-bromo-6-chloro-5-[(4-ethoxyphenyl)methyl]-3-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CC)[C@@H](C)[C@H](OCc4ccccc4)C3OCc3ccccc3)c(Br)c(O)c2Cl)cc1 |
| InChI | InChI=1S/C37H40BrClO5/c1-4-31-24(3)35(42-22-26-12-8-6-9-13-26)37(43-23-27-14-10-7-11-15-27)36(44-31)30-21-28(33(39)34(40)32(30)38)20-25-16-18-29(19-17-25)41-5-2/h6-19,21,24,31,35-37,40H,4-5,20,22-23H2,1-3H3/t24-,31-,35+,36+,37?/m1/s1 |
| InChIKey | QRWUHAMZXREYQV-HCGZQMTPSA-N |
| XLogP | 9.45 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.08 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |