C41H48ClIO6 — CID 90308358
5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6S)-6-(5-iodopentoxymethyl)-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenol (PubChem CID 90308358) has the molecular formula C41H48ClIO6 and a molecular weight of 799.19 g/mol. Its IUPAC name is 5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6S)-6-(5-iodopentoxymethyl)-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenol.
| Compound Name | 5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6S)-6-(5-iodopentoxymethyl)-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenol |
|---|---|
| PubChem CID | 90308358 |
| Molecular Formula | C41H48ClIO6 |
| Molecular Weight | 799.19 g/mol |
| Exact Mass | 798.22 |
| IUPAC Name | 5-chloro-4-[(4-ethoxyphenyl)methyl]-2-[(2S,3R,4S,5R,6S)-6-(5-iodopentoxymethyl)-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]phenol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](COCCCCCI)[C@@H](C)[C@H](OCc4ccccc4)C3OCc3ccccc3)c(O)cc2Cl)cc1 |
| InChI | InChI=1S/C41H48ClIO6/c1-3-46-34-19-17-30(18-20-34)23-33-24-35(37(44)25-36(33)42)40-41(48-27-32-15-9-5-10-16-32)39(47-26-31-13-7-4-8-14-31)29(2)38(49-40)28-45-22-12-6-11-21-43/h4-5,7-10,13-20,24-25,29,38-41,44H,3,6,11-12,21-23,26-28H2,1-2H3/t29-,38-,39+,40+,41?/m1/s1 |
| InChIKey | FPHWXXJMCBNZDZ-WNVXFGJQSA-N |
| XLogP | 9.90 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.19 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|