C50H51ClO6 — CID 59235342
[5-chloro-4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]-dideuteriomethanol (PubChem CID 59235342) has the molecular formula C50H51ClO6 and a molecular weight of 785.42 g/mol. Its IUPAC name is [5-chloro-4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]-dideuteriomethanol.
| Compound Name | [5-chloro-4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]-dideuteriomethanol |
|---|---|
| PubChem CID | 59235342 |
| Molecular Formula | C50H51ClO6 |
| Molecular Weight | 785.42 g/mol |
| Exact Mass | 784.35 |
| IUPAC Name | [5-chloro-4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]-dideuteriomethanol |
| SMILES | [2H]C([2H])(O)c1cc(Cl)c(Cc2ccc(CC)cc2)cc1[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C50H51ClO6/c1-2-36-23-25-37(26-24-36)27-42-28-44(43(30-52)29-45(42)51)47-49(55-33-40-19-11-5-12-20-40)50(56-34-41-21-13-6-14-22-41)48(54-32-39-17-9-4-10-18-39)46(57-47)35-53-31-38-15-7-3-8-16-38/h3-26,28-29,46-50,52H,2,27,30-35H2,1H3/t46-,47+,48-,49?,50+/m1/s1/i30D2 |
| InChIKey | KGCSLLHUHOBURO-BOCBWQELSA-N |
| XLogP | 10.40 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.42 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |