C47H46O8 — CID 67287387
2-[1-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]naphthalen-2-yl]acetic acid (PubChem CID 67287387) has the molecular formula C47H46O8 and a molecular weight of 738.88 g/mol. Its IUPAC name is 2-[1-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[1-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 67287387 |
| Molecular Formula | C47H46O8 |
| Molecular Weight | 738.88 g/mol |
| Exact Mass | 738.32 |
| IUPAC Name | 2-[1-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]naphthalen-2-yl]acetic acid |
| SMILES | COc1c(CC(=O)O)cc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C47H46O8/c1-50-43-37(27-42(48)49)26-40(38-24-14-15-25-39(38)43)44-46(53-30-35-20-10-4-11-21-35)47(54-31-36-22-12-5-13-23-36)45(52-29-34-18-8-3-9-19-34)41(55-44)32-51-28-33-16-6-2-7-17-33/h2-26,41,44-47H,27-32H2,1H3,(H,48,49)/t41-,44+,45-,46+,47+/m1/s1 |
| InChIKey | CMXTWNPRCHFWHW-LSNBXLLPSA-N |
| XLogP | 8.89 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.88 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |