C34H34N2O8 — CID 134912960
dimethyl 4-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyridazine-3,6-dicarboxylate (PubChem CID 134912960) has the molecular formula C34H34N2O8 and a molecular weight of 598.65 g/mol. Its IUPAC name is dimethyl 4-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyridazine-3,6-dicarboxylate.
| Compound Name | dimethyl 4-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyridazine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 134912960 |
| Molecular Formula | C34H34N2O8 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | dimethyl 4-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyridazine-3,6-dicarboxylate |
| SMILES | COC(=O)c1cc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c(C(=O)OC)nn1 |
| InChI | InChI=1S/C34H34N2O8/c1-39-33(37)27-18-26(29(36-35-27)34(38)40-2)30-32(43-21-25-16-10-5-11-17-25)31(42-20-24-14-8-4-9-15-24)28(44-30)22-41-19-23-12-6-3-7-13-23/h3-18,28,30-32H,19-22H2,1-2H3/t28-,30+,31-,32+/m1/s1 |
| InChIKey | SVLKVBDJPPSZJG-HMMMRCIUSA-N |
| XLogP | 4.88 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |