C42H43NO8 — CID 102442996
methyl 6-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]pyridine-2-carboxylate (PubChem CID 102442996) has the molecular formula C42H43NO8 and a molecular weight of 689.81 g/mol. Its IUPAC name is methyl 6-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 102442996 |
| Molecular Formula | C42H43NO8 |
| Molecular Weight | 689.81 g/mol |
| Exact Mass | 689.30 |
| IUPAC Name | methyl 6-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CO[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)n1 |
| InChI | InChI=1S/C42H43NO8/c1-45-41(44)36-24-14-23-35(43-36)29-50-42-40(49-28-34-21-12-5-13-22-34)39(48-27-33-19-10-4-11-20-33)38(47-26-32-17-8-3-9-18-32)37(51-42)30-46-25-31-15-6-2-7-16-31/h2-24,37-40,42H,25-30H2,1H3/t37-,38-,39+,40-,42-/m1/s1 |
| InChIKey | JMMITILTAIMIQN-ZFTSKOLOSA-N |
| XLogP | 7.08 |
| TPSA | 94.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.81 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |