C22H27NO12 — CID 102442994
methyl 6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxymethyl]pyridine-2-carboxylate (PubChem CID 102442994) has the molecular formula C22H27NO12 and a molecular weight of 497.45 g/mol. Its IUPAC name is methyl 6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxymethyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxymethyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 102442994 |
| Molecular Formula | C22H27NO12 |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | methyl 6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxymethyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CO[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)n1 |
| InChI | InChI=1S/C22H27NO12/c1-11(24)30-10-17-18(32-12(2)25)19(33-13(3)26)20(34-14(4)27)22(35-17)31-9-15-7-6-8-16(23-15)21(28)29-5/h6-8,17-20,22H,9-10H2,1-5H3/t17-,18-,19+,20-,22-/m1/s1 |
| InChIKey | DSYQRCGUOGZYPV-OUUKCGNVSA-N |
| XLogP | 0.47 |
| TPSA | 162.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|