C41H42O8 — CID 10897647
methyl 5-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]furan-2-carboxylate (PubChem CID 10897647) has the molecular formula C41H42O8 and a molecular weight of 662.78 g/mol. Its IUPAC name is methyl 5-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 10897647 |
| Molecular Formula | C41H42O8 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | methyl 5-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)o1 |
| InChI | InChI=1S/C41H42O8/c1-43-41(42)35-23-22-34(48-35)24-36-38(45-26-31-16-8-3-9-17-31)40(47-28-33-20-12-5-13-21-33)39(46-27-32-18-10-4-11-19-32)37(49-36)29-44-25-30-14-6-2-7-15-30/h2-23,36-40H,24-29H2,1H3/t36-,37+,38-,39+,40+/m0/s1 |
| InChIKey | NOWXGSVKWZHYBP-WBHVZLLVSA-N |
| XLogP | 7.35 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |