C48H46N2O9 — CID 16753169
dimethyl 4-phenyl-5-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pyridazine-3,6-dicarboxylate (PubChem CID 16753169) has the molecular formula C48H46N2O9 and a molecular weight of 794.90 g/mol. Its IUPAC name is dimethyl 4-phenyl-5-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pyridazine-3,6-dicarboxylate.
| Compound Name | dimethyl 4-phenyl-5-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pyridazine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 16753169 |
| Molecular Formula | C48H46N2O9 |
| Molecular Weight | 794.90 g/mol |
| Exact Mass | 794.32 |
| IUPAC Name | dimethyl 4-phenyl-5-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pyridazine-3,6-dicarboxylate |
| SMILES | COC(=O)c1nnc(C(=O)OC)c([C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C48H46N2O9/c1-53-47(51)41-39(37-26-16-7-17-27-37)40(42(50-49-41)48(52)54-2)44-46(58-31-36-24-14-6-15-25-36)45(57-30-35-22-12-5-13-23-35)43(56-29-34-20-10-4-11-21-34)38(59-44)32-55-28-33-18-8-3-9-19-33/h3-27,38,43-46H,28-32H2,1-2H3/t38-,43-,44-,45+,46?/m1/s1 |
| InChIKey | NFEYJPPQCCAUPQ-FEXXHYSCSA-N |
| XLogP | 8.13 |
| TPSA | 124.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.90 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |