C42H44O8 — CID 134832818
4,5-dimethoxy-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenol (PubChem CID 134832818) has the molecular formula C42H44O8 and a molecular weight of 676.81 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenol.
| Compound Name | 4,5-dimethoxy-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenol |
|---|---|
| PubChem CID | 134832818 |
| Molecular Formula | C42H44O8 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | 4,5-dimethoxy-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenol |
| SMILES | COc1cc(O)c([C@@H]2OC(COCc3ccccc3)[C@@H](OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C42H44O8/c1-44-36-23-34(35(43)24-37(36)45-2)39-41(48-27-32-19-11-5-12-20-32)42(49-28-33-21-13-6-14-22-33)40(47-26-31-17-9-4-10-18-31)38(50-39)29-46-25-30-15-7-3-8-16-30/h3-24,38-43H,25-29H2,1-2H3/t38?,39-,40+,41?,42?/m0/s1 |
| InChIKey | PECICQVCNUMQHK-BBQDCZSWSA-N |
| XLogP | 7.82 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |