C43H46O10 — CID 101120435
3,4,5-trimethoxy-2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenol (PubChem CID 101120435) has the molecular formula C43H46O10 and a molecular weight of 722.83 g/mol. Its IUPAC name is 3,4,5-trimethoxy-2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenol.
| Compound Name | 3,4,5-trimethoxy-2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenol |
|---|---|
| PubChem CID | 101120435 |
| Molecular Formula | C43H46O10 |
| Molecular Weight | 722.83 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | 3,4,5-trimethoxy-2-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenol |
| SMILES | COc1cc(O)c(O[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C43H46O10/c1-45-35-24-34(44)37(40(47-3)38(35)46-2)53-43-42(51-28-33-22-14-7-15-23-33)41(50-27-32-20-12-6-13-21-32)39(49-26-31-18-10-5-11-19-31)36(52-43)29-48-25-30-16-8-4-9-17-30/h4-24,36,39,41-44H,25-29H2,1-3H3/t36-,39-,41+,42-,43+/m1/s1 |
| InChIKey | LYHNQKFKEGYALX-DEVVCKKGSA-N |
| XLogP | 7.49 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.83 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |