C45H46O10 — CID 54507216
3-[3,5-dimethoxy-4-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 54507216) has the molecular formula C45H46O10 and a molecular weight of 746.85 g/mol. Its IUPAC name is 3-[3,5-dimethoxy-4-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3,5-dimethoxy-4-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54507216 |
| Molecular Formula | C45H46O10 |
| Molecular Weight | 746.85 g/mol |
| Exact Mass | 746.31 |
| IUPAC Name | 3-[3,5-dimethoxy-4-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)cc(OC)c1O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C45H46O10/c1-48-37-25-36(23-24-40(46)47)26-38(49-2)41(37)55-45-44(53-30-35-21-13-6-14-22-35)43(52-29-34-19-11-5-12-20-34)42(51-28-33-17-9-4-10-18-33)39(54-45)31-50-27-32-15-7-3-8-16-32/h3-26,39,42-45H,27-31H2,1-2H3,(H,46,47)/t39-,42-,43+,44+,45-/m1/s1 |
| InChIKey | YGOGYNJWCVGFCQ-KXOFEISSSA-N |
| XLogP | 7.88 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.85 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|