C37H53ClO6S — CID 71199727
4-(1-benzothiophen-2-ylmethyl)-5-chloro-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol (PubChem CID 71199727) has the molecular formula C37H53ClO6S and a molecular weight of 661.35 g/mol. Its IUPAC name is 4-(1-benzothiophen-2-ylmethyl)-5-chloro-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol.
| Compound Name | 4-(1-benzothiophen-2-ylmethyl)-5-chloro-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol |
|---|---|
| PubChem CID | 71199727 |
| Molecular Formula | C37H53ClO6S |
| Molecular Weight | 661.35 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | 4-(1-benzothiophen-2-ylmethyl)-5-chloro-2-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenol |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(Cc3cc4ccccc4s3)c(Cl)cc2O)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C37H53ClO6S/c1-5-9-17-40-25-32-35(41-18-10-6-2)37(43-20-12-8-4)36(42-19-11-7-3)34(44-32)29-23-27(30(38)24-31(29)39)22-28-21-26-15-13-14-16-33(26)45-28/h13-16,21,23-24,32,34-37,39H,5-12,17-20,22,25H2,1-4H3/t32-,34+,35-,36+,37+/m1/s1 |
| InChIKey | ZASSMMJCJMWNEI-YEZGUQQHSA-N |
| XLogP | 9.66 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.35 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|