C37H53FO5S — CID 67962061
2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane (PubChem CID 67962061) has the molecular formula C37H53FO5S and a molecular weight of 628.89 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane.
| Compound Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane |
|---|---|
| PubChem CID | 67962061 |
| Molecular Formula | C37H53FO5S |
| Molecular Weight | 628.89 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane |
| SMILES | CCCCOCC1OC(c2ccc(F)c(Cc3cc4ccccc4s3)c2)C(OCCCC)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C37H53FO5S/c1-5-9-19-39-26-32-35(40-20-10-6-2)37(42-22-12-8-4)36(41-21-11-7-3)34(43-32)28-17-18-31(38)29(23-28)25-30-24-27-15-13-14-16-33(27)44-30/h13-18,23-24,32,34-37H,5-12,19-22,25-26H2,1-4H3 |
| InChIKey | GUKXKUDWLZUZRL-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.89 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|