C22H23FO3S — CID 118457936
2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-(hydroxymethyl)-3-methyloxan-4-ol (PubChem CID 118457936) has the molecular formula C22H23FO3S and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-(hydroxymethyl)-3-methyloxan-4-ol.
| Compound Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-(hydroxymethyl)-3-methyloxan-4-ol |
|---|---|
| PubChem CID | 118457936 |
| Molecular Formula | C22H23FO3S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-(hydroxymethyl)-3-methyloxan-4-ol |
| SMILES | CC1C(O)CC(CO)OC1c1ccc(F)c(Cc2cc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H23FO3S/c1-13-20(25)11-17(12-24)26-22(13)15-6-7-19(23)16(8-15)10-18-9-14-4-2-3-5-21(14)27-18/h2-9,13,17,20,22,24-25H,10-12H2,1H3 |
| InChIKey | UGTOWEQSAQGJFG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |