C25H32N2O5S — CID 118696561
(3S,4S)-3-aminooxy-2-[3-(1-benzothiophen-2-ylmethyl)-4-[2-(dimethylamino)ethoxy]phenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 118696561) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is (3S,4S)-3-aminooxy-2-[3-(1-benzothiophen-2-ylmethyl)-4-[2-(dimethylamino)ethoxy]phenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | (3S,4S)-3-aminooxy-2-[3-(1-benzothiophen-2-ylmethyl)-4-[2-(dimethylamino)ethoxy]phenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 118696561 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (3S,4S)-3-aminooxy-2-[3-(1-benzothiophen-2-ylmethyl)-4-[2-(dimethylamino)ethoxy]phenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CN(C)CCOc1ccc(C2OC(CO)C[C@H](O)[C@@H]2ON)cc1Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C25H32N2O5S/c1-27(2)9-10-30-22-8-7-17(24-25(32-26)21(29)14-19(15-28)31-24)11-18(22)13-20-12-16-5-3-4-6-23(16)33-20/h3-8,11-12,19,21,24-25,28-29H,9-10,13-15,26H2,1-2H3/t19?,21-,24?,25-/m0/s1 |
| InChIKey | DUTDLPRMJOSLIF-JAFKXMBJSA-N |
| XLogP | 2.87 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|