C21H21ClO2S2 — CID 156738118
2-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-6-(hydroxymethyl)thian-4-ol (PubChem CID 156738118) has the molecular formula C21H21ClO2S2 and a molecular weight of 404.98 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-6-(hydroxymethyl)thian-4-ol.
| Compound Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-6-(hydroxymethyl)thian-4-ol |
|---|---|
| PubChem CID | 156738118 |
| Molecular Formula | C21H21ClO2S2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-6-(hydroxymethyl)thian-4-ol |
| SMILES | OCC1CC(O)CC(c2ccc(Cl)c(Cc3cc4ccccc4s3)c2)S1 |
| InChI | InChI=1S/C21H21ClO2S2/c22-19-6-5-14(21-11-16(24)10-18(12-23)26-21)7-15(19)9-17-8-13-3-1-2-4-20(13)25-17/h1-8,16,18,21,23-24H,9-12H2 |
| InChIKey | NDHDEXCWZTXUKU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |