C21H20ClFO4S — CID 23725182
(2S,3R,4R,5R,6R)-2-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-5-fluoro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 23725182) has the molecular formula C21H20ClFO4S and a molecular weight of 422.91 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-5-fluoro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-5-fluoro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 23725182 |
| Molecular Formula | C21H20ClFO4S |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[3-(1-benzothiophen-2-ylmethyl)-4-chlorophenyl]-5-fluoro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3cc4ccccc4s3)c2)[C@H](O)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C21H20ClFO4S/c22-15-6-5-12(21-20(26)19(25)18(23)16(10-24)27-21)7-13(15)9-14-8-11-3-1-2-4-17(11)28-14/h1-8,16,18-21,24-26H,9-10H2/t16-,18+,19+,20-,21+/m1/s1 |
| InChIKey | DCMIGJKWGAGXPD-RQSWOZRGSA-N |
| XLogP | 3.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |