C26H28FNO6S — CID 131698388
[(2R,3S,4R,5R,6S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 131698388) has the molecular formula C26H28FNO6S and a molecular weight of 501.58 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 131698388 |
| Molecular Formula | C26H28FNO6S |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(O[C@H]1[C@H](O)[C@@H](O)[C@H](c2ccc(F)c(Cc3cc4ccccc4s3)c2)O[C@@H]1CO)[C@@H]1CCCN1 |
| InChI | InChI=1S/C26H28FNO6S/c27-18-8-7-15(10-16(18)12-17-11-14-4-1-2-6-21(14)35-17)24-22(30)23(31)25(20(13-29)33-24)34-26(32)19-5-3-9-28-19/h1-2,4,6-8,10-11,19-20,22-25,28-31H,3,5,9,12-13H2/t19-,20+,22+,23+,24-,25+/m0/s1 |
| InChIKey | FSQKGVCVJJIQFB-OKQFDTRBSA-N |
| XLogP | 2.45 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |