C33H44ClF3N2O11 — CID 46182242
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;bis((2S)-pyrrolidine-2-carboxylic acid) (PubChem CID 46182242) has the molecular formula C33H44ClF3N2O11 and a molecular weight of 737.16 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;bis((2S)-pyrrolidine-2-carboxylic acid).
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;bis((2S)-pyrrolidine-2-carboxylic acid) |
|---|---|
| PubChem CID | 46182242 |
| Molecular Formula | C33H44ClF3N2O11 |
| Molecular Weight | 737.16 g/mol |
| Exact Mass | 736.26 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;bis((2S)-pyrrolidine-2-carboxylic acid) |
| SMILES | O=C(O)[C@@H]1CCCN1.O=C(O)[C@@H]1CCCN1.OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OCCOCC(F)(F)F)cc3)c2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H26ClF3O7.2C5H9NO2/c24-17-6-3-14(22-21(31)20(30)19(29)18(11-28)34-22)10-15(17)9-13-1-4-16(5-2-13)33-8-7-32-12-23(25,26)27;2*7-5(8)4-2-1-3-6-4/h1-6,10,18-22,28-31H,7-9,11-12H2;2*4,6H,1-3H2,(H,7,8)/t18-,19-,20+,21?,22+;2*4-/m100/s1 |
| InChIKey | HPXYPRLALQUNPH-YEARCEBHSA-N |
| XLogP | 2.05 |
| TPSA | 207.27 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|