C27H34ClNO7 — CID 159118578
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-[4-(1-deuteriocyclopropyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 159118578) has the molecular formula C27H34ClNO7 and a molecular weight of 523.04 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-[4-(1-deuteriocyclopropyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;(2S)-pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-[4-(1-deuteriocyclopropyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;(2S)-pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 159118578 |
| Molecular Formula | C27H34ClNO7 |
| Molecular Weight | 523.04 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-[4-(1-deuteriocyclopropyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1.[2H]C1(c2ccc(C([2H])([2H])c3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C22H25ClO5.C5H9NO2/c23-17-8-7-15(22-21(27)20(26)19(25)18(11-24)28-22)10-16(17)9-12-1-3-13(4-2-12)14-5-6-14;7-5(8)4-2-1-3-6-4/h1-4,7-8,10,14,18-22,24-27H,5-6,9,11H2;4,6H,1-3H2,(H,7,8)/t18-,19-,20+,21-,22+;4-/m10/s1/i9D2,14D; |
| InChIKey | KFJZAWSZUKEHFY-OYTSRBMQSA-N |
| XLogP | 2.15 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.04 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |