C20H23ClO6 — CID 45101346
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-[4-(trideuteriomethoxy)phenyl]methyl]phenyl]-2-deuterio-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 45101346) has the molecular formula C20H23ClO6 and a molecular weight of 400.89 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-[4-(trideuteriomethoxy)phenyl]methyl]phenyl]-2-deuterio-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-[4-(trideuteriomethoxy)phenyl]methyl]phenyl]-2-deuterio-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 45101346 |
| Molecular Formula | C20H23ClO6 |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-[4-(trideuteriomethoxy)phenyl]methyl]phenyl]-2-deuterio-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C([2H])([2H])c2cc([C@]3([2H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H23ClO6/c1-26-14-5-2-11(3-6-14)8-13-9-12(4-7-15(13)21)20-19(25)18(24)17(23)16(10-22)27-20/h2-7,9,16-20,22-25H,8,10H2,1H3/t16-,17-,18+,19-,20+/m1/s1/i1D3,8D2,20D |
| InChIKey | UEHTWMMZNLKDPS-BJVBGFNOSA-N |
| XLogP | 1.45 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |