C19H19ClF2O6 — CID 45107745
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-(3,5-difluoro-4-hydroxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 45107745) has the molecular formula C19H19ClF2O6 and a molecular weight of 418.82 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-(3,5-difluoro-4-hydroxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-(3,5-difluoro-4-hydroxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 45107745 |
| Molecular Formula | C19H19ClF2O6 |
| Molecular Weight | 418.82 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[dideuterio-(3,5-difluoro-4-hydroxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [2H]C([2H])(c1cc(F)c(O)c(F)c1)c1cc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc1Cl |
| InChI | InChI=1S/C19H19ClF2O6/c20-11-2-1-9(19-18(27)17(26)16(25)14(7-23)28-19)6-10(11)3-8-4-12(21)15(24)13(22)5-8/h1-2,4-6,14,16-19,23-27H,3,7H2/t14-,16-,17+,18-,19+/m1/s1/i3D2 |
| InChIKey | OOPIEJMTDKEBGJ-VMLJIXEKSA-N |
| XLogP | 1.43 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.82 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |