C20H22ClFO5S — CID 70828012
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(2-fluoro-4-methylsulfanylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 70828012) has the molecular formula C20H22ClFO5S and a molecular weight of 428.91 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(2-fluoro-4-methylsulfanylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(2-fluoro-4-methylsulfanylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70828012 |
| Molecular Formula | C20H22ClFO5S |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(2-fluoro-4-methylsulfanylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CSc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C20H22ClFO5S/c1-28-13-4-2-10(15(22)8-13)6-12-7-11(3-5-14(12)21)20-19(26)18(25)17(24)16(9-23)27-20/h2-5,7-8,16-20,23-26H,6,9H2,1H3/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | SHBKCEHINXQMIB-OBKDMQGPSA-N |
| XLogP | 2.31 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |