C21H23ClF2O5 — CID 45107701
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[3,5-difluoro-4-(1,1,2,2,2-pentadeuterioethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 45107701) has the molecular formula C21H23ClF2O5 and a molecular weight of 433.89 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[3,5-difluoro-4-(1,1,2,2,2-pentadeuterioethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[3,5-difluoro-4-(1,1,2,2,2-pentadeuterioethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 45107701 |
| Molecular Formula | C21H23ClF2O5 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[3,5-difluoro-4-(1,1,2,2,2-pentadeuterioethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1c(F)cc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1F |
| InChI | InChI=1S/C21H23ClF2O5/c1-2-13-15(23)6-10(7-16(13)24)5-12-8-11(3-4-14(12)22)21-20(28)19(27)18(26)17(9-25)29-21/h3-4,6-8,17-21,25-28H,2,5,9H2,1H3/t17-,18-,19+,20-,21+/m1/s1/i1D3,2D2 |
| InChIKey | PVJZSBGPDWCTBG-CAXKFZQOSA-N |
| XLogP | 2.29 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |