C21H25F2NO5 — CID 89261051
(2S,3R,4R,5S,6R)-2-[4-amino-3-[(4-ethyl-2,6-difluorophenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89261051) has the molecular formula C21H25F2NO5 and a molecular weight of 409.43 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-amino-3-[(4-ethyl-2,6-difluorophenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[(4-ethyl-2,6-difluorophenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89261051 |
| Molecular Formula | C21H25F2NO5 |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-amino-3-[(4-ethyl-2,6-difluorophenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1cc(F)c(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)C3O)ccc2N)c(F)c1 |
| InChI | InChI=1S/C21H25F2NO5/c1-2-10-5-14(22)13(15(23)6-10)8-12-7-11(3-4-16(12)24)21-20(28)19(27)18(26)17(9-25)29-21/h3-7,17-21,25-28H,2,8-9,24H2,1H3/t17-,18-,19+,20?,21+/m1/s1 |
| InChIKey | STKKTTWGPAYHPM-BKUVARHGSA-N |
| XLogP | 1.22 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|