C21H21FO5 — CID 154283673
(3R,4R,5S,6R)-2-[3-[(4-ethynylphenyl)methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 154283673) has the molecular formula C21H21FO5 and a molecular weight of 372.39 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[3-[(4-ethynylphenyl)methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[3-[(4-ethynylphenyl)methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 154283673 |
| Molecular Formula | C21H21FO5 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (3R,4R,5S,6R)-2-[3-[(4-ethynylphenyl)methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C#Cc1ccc(Cc2cc(C3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2F)cc1 |
| InChI | InChI=1S/C21H21FO5/c1-2-12-3-5-13(6-4-12)9-15-10-14(7-8-16(15)22)21-20(26)19(25)18(24)17(11-23)27-21/h1,3-8,10,17-21,23-26H,9,11H2/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | WHAJWYIDAZPLPL-AWGDKMGJSA-N |
| XLogP | 0.91 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|