C27H33NO6 — CID 143401080
2-[(4-ethynylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile;methane;oxolane (PubChem CID 143401080) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is 2-[(4-ethynylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile;methane;oxolane.
| Compound Name | 2-[(4-ethynylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile;methane;oxolane |
|---|---|
| PubChem CID | 143401080 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 2-[(4-ethynylphenyl)methyl]-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzonitrile;methane;oxolane |
| SMILES | C.C#Cc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2C#N)cc1.C1CCOC1 |
| InChI | InChI=1S/C22H21NO5.C4H8O.CH4/c1-2-13-3-5-14(6-4-13)9-17-10-15(7-8-16(17)11-23)22-21(27)20(26)19(25)18(12-24)28-22;1-2-4-5-3-1;/h1,3-8,10,18-22,24-27H,9,12H2;1-4H2;1H4/t18-,19-,20+,21-,22+;;/m1../s1 |
| InChIKey | VJJVGIPVQXBYHO-LYSZPAISSA-N |
| XLogP | 2.08 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|