C23H23NO4 — CID 58587512
2-[(2R,3S,4S,5R,6S)-6-[3-[(4-ethynylphenyl)methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]acetonitrile (PubChem CID 58587512) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R,6S)-6-[3-[(4-ethynylphenyl)methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]acetonitrile.
| Compound Name | 2-[(2R,3S,4S,5R,6S)-6-[3-[(4-ethynylphenyl)methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]acetonitrile |
|---|---|
| PubChem CID | 58587512 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[(2R,3S,4S,5R,6S)-6-[3-[(4-ethynylphenyl)methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]acetonitrile |
| SMILES | C#Cc1ccc(Cc2cc([C@@H]3O[C@H](CC#N)[C@@H](O)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-3-15-5-7-16(8-6-15)12-18-13-17(9-4-14(18)2)23-22(27)21(26)20(25)19(28-23)10-11-24/h1,4-9,13,19-23,25-27H,10,12H2,2H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | FYXITLCVWQIHGO-ZQGJOIPISA-N |
| XLogP | 2.00 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|