C25H25FO5 — CID 86267855
(2S,3R,4R,5S,6R)-2-[4-fluoro-3-[(4-phenylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 86267855) has the molecular formula C25H25FO5 and a molecular weight of 424.47 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-fluoro-3-[(4-phenylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-fluoro-3-[(4-phenylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 86267855 |
| Molecular Formula | C25H25FO5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-fluoro-3-[(4-phenylphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(F)c(Cc3ccc(-c4ccccc4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H25FO5/c26-20-11-10-18(25-24(30)23(29)22(28)21(14-27)31-25)13-19(20)12-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-11,13,21-25,27-30H,12,14H2/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | IBLTTZVBOMGBFU-RXFVIIJJSA-N |
| XLogP | 2.60 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |