C23H23FO5 — CID 10475978
(3R,4R,5S,6R)-2-[5-(azulen-2-ylmethyl)-2-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10475978) has the molecular formula C23H23FO5 and a molecular weight of 398.43 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[5-(azulen-2-ylmethyl)-2-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[5-(azulen-2-ylmethyl)-2-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10475978 |
| Molecular Formula | C23H23FO5 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (3R,4R,5S,6R)-2-[5-(azulen-2-ylmethyl)-2-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(c2cc(Cc3cc4cccccc-4c3)ccc2F)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H23FO5/c24-18-7-6-13(8-14-9-15-4-2-1-3-5-16(15)10-14)11-17(18)23-22(28)21(27)20(26)19(12-25)29-23/h1-7,9-11,19-23,25-28H,8,12H2/t19-,20-,21+,22-,23?/m1/s1 |
| InChIKey | PNHTZOOMMJXJGI-HZQGQDIUSA-N |
| XLogP | 2.04 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |